C17H20BF3N6O4S — CID 145279867
N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl)-1,3-thiazol-4-yl]-5-methoxy-3-methylpyrazine-2-carboxamide;trifluoroborane (PubChem CID 145279867) has the molecular formula C17H20BF3N6O4S and a molecular weight of 472.26 g/mol. Its IUPAC name is N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl)-1,3-thiazol-4-yl]-5-methoxy-3-methylpyrazine-2-carboxamide;trifluoroborane.
| Compound Name | N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl)-1,3-thiazol-4-yl]-5-methoxy-3-methylpyrazine-2-carboxamide;trifluoroborane |
|---|---|
| PubChem CID | 145279867 |
| Molecular Formula | C17H20BF3N6O4S |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl)-1,3-thiazol-4-yl]-5-methoxy-3-methylpyrazine-2-carboxamide;trifluoroborane |
| SMILES | COc1cnc(C(=O)Nc2csc(C34COCCC3COC(N)=N4)n2)c(C)n1.FB(F)F |
| InChI | InChI=1S/C17H20N6O4S.BF3/c1-9-13(19-5-12(20-9)25-2)14(24)21-11-7-28-15(22-11)17-8-26-4-3-10(17)6-27-16(18)23-17;2-1(3)4/h5,7,10H,3-4,6,8H2,1-2H3,(H2,18,23)(H,21,24); |
| InChIKey | UGZJDHTVRDUDCP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|