C16H17F3N6O2S2 — CID 144942335
N-[2-[(4aR,8aR)-2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 144942335) has the molecular formula C16H17F3N6O2S2 and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[2-[(4aR,8aR)-2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-[(4aR,8aR)-2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144942335 |
| Molecular Formula | C16H17F3N6O2S2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[2-[(4aR,8aR)-2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2csc([C@]34COCC[C@H]3CSC(N)=N4)n2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H17F3N6O2S2/c1-25-4-9(11(24-25)16(17,18)19)12(26)21-10-6-28-13(22-10)15-7-27-3-2-8(15)5-29-14(20)23-15/h4,6,8H,2-3,5,7H2,1H3,(H2,20,23)(H,21,26)/t8-,15-/m0/s1 |
| InChIKey | LCTAPGHLOCTSDX-AYVTZFPOSA-N |
| XLogP | 2.44 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |