C20H27BN2O3 — CID 140781688
trans-(1S,2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]cyclopentan-1-ol (PubChem CID 140781688) has the molecular formula C20H27BN2O3 and a molecular weight of 354.26 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 140781688 |
| Molecular Formula | C20H27BN2O3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | trans-(1S,2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]cyclopentan-1-ol |
| SMILES | CC1(C)OB(c2ccc(-c3cnn([C@H]4CCC[C@@H]4O)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H27BN2O3/c1-19(2)20(3,4)26-21(25-19)16-10-8-14(9-11-16)15-12-22-23(13-15)17-6-5-7-18(17)24/h8-13,17-18,24H,5-7H2,1-4H3/t17-,18-/m0/s1 |
| InChIKey | UXRSZFUAPMDVPA-ROUUACIJSA-N |
| XLogP | 2.94 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|