C24H35N3Sn — CID 140783416
tributyl-(6-pyrrolo[2,3-c]pyridin-1-yl-3-pyridinyl)stannane (PubChem CID 140783416) has the molecular formula C24H35N3Sn and a molecular weight of 484.28 g/mol. Its IUPAC name is tributyl-(6-pyrrolo[2,3-c]pyridin-1-yl-3-pyridinyl)stannane.
| Compound Name | tributyl-(6-pyrrolo[2,3-c]pyridin-1-yl-3-pyridinyl)stannane |
|---|---|
| PubChem CID | 140783416 |
| Molecular Formula | C24H35N3Sn |
| Molecular Weight | 484.28 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | tributyl-(6-pyrrolo[2,3-c]pyridin-1-yl-3-pyridinyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(-n2ccc3ccncc32)nc1 |
| InChI | InChI=1S/C12H8N3.3C4H9.Sn/c1-2-6-14-12(3-1)15-8-5-10-4-7-13-9-11(10)15;3*1-3-4-2;/h1,3-9H;3*1,3-4H2,2H3; |
| InChIKey | QDMHBOXBZXBNEU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.28 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |