C22H26N7O+ — CID 140785329
[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-methyl-2-(2H-triazol-1-ium-1-yl)phenyl]methanone (PubChem CID 140785329) has the molecular formula C22H26N7O+ and a molecular weight of 404.50 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-methyl-2-(2H-triazol-1-ium-1-yl)phenyl]methanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-methyl-2-(2H-triazol-1-ium-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 140785329 |
| Molecular Formula | C22H26N7O+ |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[5-methyl-2-(2H-triazol-1-ium-1-yl)phenyl]methanone |
| SMILES | Cc1ccc(-[n+]2ccn[nH]2)c(C(=O)N2CC3CN(c4nc(C)cc(C)n4)CC3C2)c1 |
| InChI | InChI=1S/C22H25N7O/c1-14-4-5-20(29-7-6-23-26-29)19(8-14)21(30)27-10-17-12-28(13-18(17)11-27)22-24-15(2)9-16(3)25-22/h4-9,17-18H,10-13H2,1-3H3/p+1 |
| InChIKey | DLAVJECRFINPIT-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|