C29H24N6O2 — CID 140786754
5-[6-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-oxo-7-phenyl-7H-naphthalen-1-yl]-1-methylpyridin-2-one (PubChem CID 140786754) has the molecular formula C29H24N6O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 5-[6-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-oxo-7-phenyl-7H-naphthalen-1-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[6-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-oxo-7-phenyl-7H-naphthalen-1-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 140786754 |
| Molecular Formula | C29H24N6O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 5-[6-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-oxo-7-phenyl-7H-naphthalen-1-yl]-1-methylpyridin-2-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)C1=Cc2cccc(-c3ccc(=O)n(C)c3)c2C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C29H24N6O2/c1-17(33-28-23(31-2)15-32-29(30)34-28)22-14-19-10-7-11-21(20-12-13-24(36)35(3)16-20)26(19)27(37)25(22)18-8-5-4-6-9-18/h4-17,25H,1,3H3,(H3,30,32,33,34)/t17-,25?/m0/s1 |
| InChIKey | RQRSPRTYRPDISE-LFUZPPSTSA-N |
| XLogP | 4.84 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|