C19H22N5O2+ — CID 140786944
1-(1-carbamimidoylpyridin-1-ium-4-carbonyl)-4-methyl-N-phenylpyrrolidine-2-carboxamide (PubChem CID 140786944) has the molecular formula C19H22N5O2+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-(1-carbamimidoylpyridin-1-ium-4-carbonyl)-4-methyl-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-(1-carbamimidoylpyridin-1-ium-4-carbonyl)-4-methyl-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140786944 |
| Molecular Formula | C19H22N5O2+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-(1-carbamimidoylpyridin-1-ium-4-carbonyl)-4-methyl-N-phenylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)[n+]1ccc(C(=O)N2CC(C)CC2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-13-11-16(17(25)22-15-5-3-2-4-6-15)24(12-13)18(26)14-7-9-23(10-8-14)19(20)21/h2-10,13,16H,11-12H2,1H3,(H3-,20,21,22,25)/p+1 |
| InChIKey | HPWXRDCYEANGJO-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|