C30H35Br2NO3SSi — CID 140789723
1,3-dibromo-5-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 140789723) has the molecular formula C30H35Br2NO3SSi and a molecular weight of 677.58 g/mol. Its IUPAC name is 1,3-dibromo-5-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1,3-dibromo-5-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 140789723 |
| Molecular Formula | C30H35Br2NO3SSi |
| Molecular Weight | 677.58 g/mol |
| Exact Mass | 675.05 |
| IUPAC Name | 1,3-dibromo-5-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CC(C)(C)[Si](OCCCCCCCCN1C(=O)c2c(Br)sc(Br)c2C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35Br2NO3SSi/c1-30(2,3)38(22-16-10-8-11-17-22,23-18-12-9-13-19-23)36-21-15-7-5-4-6-14-20-33-28(34)24-25(29(33)35)27(32)37-26(24)31/h8-13,16-19H,4-7,14-15,20-21H2,1-3H3 |
| InChIKey | NEHCQLXIVWFIAQ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.58 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|