C38H39F3IrN3- — CID 140796632
1-[3,5-bis(4-tert-butylphenyl)phenyl]-3-propyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4-triazole;iridium (PubChem CID 140796632) has the molecular formula C38H39F3IrN3- and a molecular weight of 786.96 g/mol. Its IUPAC name is 1-[3,5-bis(4-tert-butylphenyl)phenyl]-3-propyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4-triazole;iridium.
| Compound Name | 1-[3,5-bis(4-tert-butylphenyl)phenyl]-3-propyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 140796632 |
| Molecular Formula | C38H39F3IrN3- |
| Molecular Weight | 786.96 g/mol |
| Exact Mass | 787.27 |
| IUPAC Name | 1-[3,5-bis(4-tert-butylphenyl)phenyl]-3-propyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4-triazole;iridium |
| SMILES | CCCc1nc(-c2[c-]cc(C(F)(F)F)cc2)n(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c2)n1.[Ir] |
| InChI | InChI=1S/C38H39F3N3.Ir/c1-8-9-34-42-35(27-14-20-32(21-15-27)38(39,40)41)44(43-34)33-23-28(25-10-16-30(17-11-25)36(2,3)4)22-29(24-33)26-12-18-31(19-13-26)37(5,6)7;/h10-14,16-24H,8-9H2,1-7H3;/q-1; |
| InChIKey | KNWPQWWQZGJIIB-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.96 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|