C38H43N3 — CID 140803248
3-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-1-methyl-5-propyl-1,2,4-triazole (PubChem CID 140803248) has the molecular formula C38H43N3 and a molecular weight of 541.78 g/mol. Its IUPAC name is 3-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-1-methyl-5-propyl-1,2,4-triazole.
| Compound Name | 3-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-1-methyl-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 140803248 |
| Molecular Formula | C38H43N3 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | 3-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-1-methyl-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nc(-c2cccc(-c3cc(-c4ccc(C(C)(C)C)cc4)cc(-c4ccc(C(C)(C)C)cc4)c3)c2)nn1C |
| InChI | InChI=1S/C38H43N3/c1-9-11-35-39-36(40-41(35)8)29-13-10-12-28(22-29)32-24-30(26-14-18-33(19-15-26)37(2,3)4)23-31(25-32)27-16-20-34(21-17-27)38(5,6)7/h10,12-25H,9,11H2,1-8H3 |
| InChIKey | DVZHEETVBDCZGE-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |