C7H10F3NO4 — CID 140799684
2-[dimethyl-[(2,2,2-trifluoroacetyl)oxymethyl]azaniumyl]acetate (PubChem CID 140799684) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is 2-[dimethyl-[(2,2,2-trifluoroacetyl)oxymethyl]azaniumyl]acetate.
| Compound Name | 2-[dimethyl-[(2,2,2-trifluoroacetyl)oxymethyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 140799684 |
| Molecular Formula | C7H10F3NO4 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-[dimethyl-[(2,2,2-trifluoroacetyl)oxymethyl]azaniumyl]acetate |
| SMILES | C[N+](C)(COC(=O)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C7H10F3NO4/c1-11(2,3-5(12)13)4-15-6(14)7(8,9)10/h3-4H2,1-2H3 |
| InChIKey | DPDQTRRFUMRVIO-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|