C8H14F3N2O5+ — CID 130266776
dimethyl-(nitrooxymethyl)-[3-(2,2,2-trifluoroacetyl)oxypropyl]azanium (PubChem CID 130266776) has the molecular formula C8H14F3N2O5+ and a molecular weight of 275.20 g/mol. Its IUPAC name is dimethyl-(nitrooxymethyl)-[3-(2,2,2-trifluoroacetyl)oxypropyl]azanium.
| Compound Name | dimethyl-(nitrooxymethyl)-[3-(2,2,2-trifluoroacetyl)oxypropyl]azanium |
|---|---|
| PubChem CID | 130266776 |
| Molecular Formula | C8H14F3N2O5+ |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | dimethyl-(nitrooxymethyl)-[3-(2,2,2-trifluoroacetyl)oxypropyl]azanium |
| SMILES | C[N+](C)(CCCOC(=O)C(F)(F)F)CO[N+](=O)[O-] |
| InChI | InChI=1S/C8H14F3N2O5/c1-13(2,6-18-12(15)16)4-3-5-17-7(14)8(9,10)11/h3-6H2,1-2H3/q+1 |
| InChIKey | MLXQZGDSIYAOMX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|