C6H15FN3O5S+ — CID 130266778
3-(fluorosulfonylamino)propyl-dimethyl-(nitrooxymethyl)azanium (PubChem CID 130266778) has the molecular formula C6H15FN3O5S+ and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-(fluorosulfonylamino)propyl-dimethyl-(nitrooxymethyl)azanium.
| Compound Name | 3-(fluorosulfonylamino)propyl-dimethyl-(nitrooxymethyl)azanium |
|---|---|
| PubChem CID | 130266778 |
| Molecular Formula | C6H15FN3O5S+ |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(fluorosulfonylamino)propyl-dimethyl-(nitrooxymethyl)azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)F)CO[N+](=O)[O-] |
| InChI | InChI=1S/C6H15FN3O5S/c1-10(2,6-15-9(11)12)5-3-4-8-16(7,13)14/h8H,3-6H2,1-2H3/q+1 |
| InChIKey | NPABIWGBHJHWNX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|