C19H12ClO9S3-3 — CID 140801853
4-[chloro-bis(4-sulfonatophenyl)methyl]benzenesulfonate (PubChem CID 140801853) has the molecular formula C19H12ClO9S3-3 and a molecular weight of 515.95 g/mol. Its IUPAC name is 4-[chloro-bis(4-sulfonatophenyl)methyl]benzenesulfonate.
| Compound Name | 4-[chloro-bis(4-sulfonatophenyl)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 140801853 |
| Molecular Formula | C19H12ClO9S3-3 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 514.93 |
| IUPAC Name | 4-[chloro-bis(4-sulfonatophenyl)methyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(Cl)(c2ccc(S(=O)(=O)[O-])cc2)c2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H15ClO9S3/c20-19(13-1-7-16(8-2-13)30(21,22)23,14-3-9-17(10-4-14)31(24,25)26)15-5-11-18(12-6-15)32(27,28)29/h1-12H,(H,21,22,23)(H,24,25,26)(H,27,28,29)/p-3 |
| InChIKey | OAOAXSOHNMQBQB-UHFFFAOYSA-K |
| XLogP | 1.93 |
| TPSA | 171.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|