C21H39N3O4Si — CID 140804576
tert-butyl N-[3-[5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,4-oxadiazol-2-yl]cyclohexyl]carbamate (PubChem CID 140804576) has the molecular formula C21H39N3O4Si and a molecular weight of 425.65 g/mol. Its IUPAC name is tert-butyl N-[3-[5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,4-oxadiazol-2-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,4-oxadiazol-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140804576 |
| Molecular Formula | C21H39N3O4Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | tert-butyl N-[3-[5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,4-oxadiazol-2-yl]cyclohexyl]carbamate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)c1nnc(C2CCCC(NC(=O)OC(C)(C)C)C2)o1 |
| InChI | InChI=1S/C21H39N3O4Si/c1-14(28-29(8,9)21(5,6)7)17-23-24-18(26-17)15-11-10-12-16(13-15)22-19(25)27-20(2,3)4/h14-16H,10-13H2,1-9H3,(H,22,25)/t14-,15?,16?/m1/s1 |
| InChIKey | OXXKPFFLKLRMER-QQFBHYJXSA-N |
| XLogP | 5.70 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|