C28H39BN2O6 — CID 140809084
methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 140809084) has the molecular formula C28H39BN2O6 and a molecular weight of 510.44 g/mol. Its IUPAC name is methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809084 |
| Molecular Formula | C28H39BN2O6 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=CC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)[C@@H](C)OC |
| InChI | InChI=1S/C28H39BN2O6/c1-18(34-6)24(30-26(33)35-7)25(32)31-16-8-9-23(31)21-11-10-20(17-21)19-12-14-22(15-13-19)29-36-27(2,3)28(4,5)37-29/h10-15,18,23-24H,8-9,16-17H2,1-7H3,(H,30,33)/t18-,23+,24+/m1/s1 |
| InChIKey | HRIBMDYBPUPSGE-DKLXNKCPSA-N |
| XLogP | 3.45 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|