C21H23N2O2- — CID 140816513
3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)amino]benzoate (PubChem CID 140816513) has the molecular formula C21H23N2O2- and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)amino]benzoate.
| Compound Name | 3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)amino]benzoate |
|---|---|
| PubChem CID | 140816513 |
| Molecular Formula | C21H23N2O2- |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)amino]benzoate |
| SMILES | O=C([O-])c1cccc(NC2C3CCC2CN(Cc2ccccc2)C3)c1 |
| InChI | InChI=1S/C21H24N2O2/c24-21(25)16-7-4-8-19(11-16)22-20-17-9-10-18(20)14-23(13-17)12-15-5-2-1-3-6-15/h1-8,11,17-18,20,22H,9-10,12-14H2,(H,24,25)/p-1 |
| InChIKey | UYBXPYOCLDLPCB-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |