About 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium
5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium (PubChem CID 140818675) has the molecular formula C8H9N2+
and a molecular weight of 133.17 g/mol. Its IUPAC name is 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium.
Molecular Properties
| Compound Name | 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium |
| PubChem CID | 140818675 |
| Molecular Formula | C8H9N2+ |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.08 |
| IUPAC Name | 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium |
| SMILES | CC1=CC2C=CN=[N+]2C=C1 |
| InChI | InChI=1S/C8H9N2/c1-7-3-5-10-8(6-7)2-4-9-10/h2-6,8H,1H3/q+1 |
| InChIKey | ILLIBTHTNJLBEE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium?
The IUPAC name of 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium (CID 140818675) is 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium.
What is the SMILES notation for 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium?
The canonical SMILES for 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium is CC1=CC2C=CN=[N+]2C=C1.
What is the InChIKey of 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium?
The InChIKey is ILLIBTHTNJLBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2/c1-7-3-5-10-8(6-7)2-4-9-10/h2-6,8H,1H3/q+1.
What are the key properties of 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium?
5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium has a molecular weight of 133.17 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3aH-pyrazolo[1,5-a]pyridin-8-ium is sourced from PubChem (CID 140818675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).