C24H31BrO4Si — CID 140821441
benzyl 4-bromo-2-but-3-enyl-3-(2-trimethylsilylethoxymethoxy)benzoate (PubChem CID 140821441) has the molecular formula C24H31BrO4Si and a molecular weight of 491.50 g/mol. Its IUPAC name is benzyl 4-bromo-2-but-3-enyl-3-(2-trimethylsilylethoxymethoxy)benzoate.
| Compound Name | benzyl 4-bromo-2-but-3-enyl-3-(2-trimethylsilylethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 140821441 |
| Molecular Formula | C24H31BrO4Si |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | benzyl 4-bromo-2-but-3-enyl-3-(2-trimethylsilylethoxymethoxy)benzoate |
| SMILES | C=CCCc1c(C(=O)OCc2ccccc2)ccc(Br)c1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H31BrO4Si/c1-5-6-12-20-21(24(26)28-17-19-10-8-7-9-11-19)13-14-22(25)23(20)29-18-27-15-16-30(2,3)4/h5,7-11,13-14H,1,6,12,15-18H2,2-4H3 |
| InChIKey | LKBXGAJHLHASMN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|