C48H33N3Pt — CID 140824313
2-[9-(10H-benzo[h]quinolin-10-id-2-yl)-10-(2,4,6-trimethylphenyl)acridin-9-yl]-10H-benzo[h]quinolin-10-ide;platinum(2+) (PubChem CID 140824313) has the molecular formula C48H33N3Pt and a molecular weight of 846.89 g/mol. Its IUPAC name is 2-[9-(10H-benzo[h]quinolin-10-id-2-yl)-10-(2,4,6-trimethylphenyl)acridin-9-yl]-10H-benzo[h]quinolin-10-ide;platinum(2+).
| Compound Name | 2-[9-(10H-benzo[h]quinolin-10-id-2-yl)-10-(2,4,6-trimethylphenyl)acridin-9-yl]-10H-benzo[h]quinolin-10-ide;platinum(2+) |
|---|---|
| PubChem CID | 140824313 |
| Molecular Formula | C48H33N3Pt |
| Molecular Weight | 846.89 g/mol |
| Exact Mass | 846.23 |
| IUPAC Name | 2-[9-(10H-benzo[h]quinolin-10-id-2-yl)-10-(2,4,6-trimethylphenyl)acridin-9-yl]-10H-benzo[h]quinolin-10-ide;platinum(2+) |
| SMILES | Cc1cc(C)c(N2c3ccccc3C(c3ccc4ccc5ccc[c-]c5c4n3)(c3ccc4ccc5ccc[c-]c5c4n3)c3ccccc32)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C48H33N3.Pt/c1-30-28-31(2)47(32(3)29-30)51-41-18-10-8-16-39(41)48(40-17-9-11-19-42(40)51,43-26-24-35-22-20-33-12-4-6-14-37(33)45(35)49-43)44-27-25-36-23-21-34-13-5-7-15-38(34)46(36)50-44;/h4-13,16-29H,1-3H3;/q-2;+2 |
| InChIKey | JHMZJMUKFMKHEI-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.89 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|