C26H31FN4O3 — CID 140826986
[(1R,3S,4S)-3-ethoxy-4-fluorocyclopentyl]-[8-[(1R,4S)-2-oxa-5-azabicyclo[2.2.2]octan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 140826986) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is [(1R,3S,4S)-3-ethoxy-4-fluorocyclopentyl]-[8-[(1R,4S)-2-oxa-5-azabicyclo[2.2.2]octan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | [(1R,3S,4S)-3-ethoxy-4-fluorocyclopentyl]-[8-[(1R,4S)-2-oxa-5-azabicyclo[2.2.2]octan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 140826986 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [(1R,3S,4S)-3-ethoxy-4-fluorocyclopentyl]-[8-[(1R,4S)-2-oxa-5-azabicyclo[2.2.2]octan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | CCO[C@H]1C[C@@H](C(=O)N2Cc3cccnc3Nc3ccc(N4C[C@H]5CC[C@H]4CO5)cc32)C[C@@H]1F |
| InChI | InChI=1S/C26H31FN4O3/c1-2-33-24-11-17(10-21(24)27)26(32)31-13-16-4-3-9-28-25(16)29-22-8-6-18(12-23(22)31)30-14-20-7-5-19(30)15-34-20/h3-4,6,8-9,12,17,19-21,24H,2,5,7,10-11,13-15H2,1H3,(H,28,29)/t17-,19-,20+,21-,24-/m0/s1 |
| InChIKey | NKOAGOFEPIETAF-LBUOEMMASA-N |
| XLogP | 4.19 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |