C25H34FN4O2- — CID 140827158
3-cyclohexyl-3-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]propanoate (PubChem CID 140827158) has the molecular formula C25H34FN4O2- and a molecular weight of 441.57 g/mol. Its IUPAC name is 3-cyclohexyl-3-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]propanoate.
| Compound Name | 3-cyclohexyl-3-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]propanoate |
|---|---|
| PubChem CID | 140827158 |
| Molecular Formula | C25H34FN4O2- |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 3-cyclohexyl-3-[2-[[1-(7-fluoroisoquinolin-1-yl)piperidin-4-yl]amino]ethylamino]propanoate |
| SMILES | O=C([O-])CC(NCCNC1CCN(c2nccc3ccc(F)cc23)CC1)C1CCCCC1 |
| InChI | InChI=1S/C25H35FN4O2/c26-20-7-6-18-8-11-29-25(22(18)16-20)30-14-9-21(10-15-30)27-12-13-28-23(17-24(31)32)19-4-2-1-3-5-19/h6-8,11,16,19,21,23,27-28H,1-5,9-10,12-15,17H2,(H,31,32)/p-1 |
| InChIKey | BYBQMBSIPNSZMP-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|