C25H30N4O2 — CID 155549058
4-[3-(4-isoquinolin-1-ylpiperazin-1-yl)propylamino]-5,6,7,8-tetrahydrochromen-2-one (PubChem CID 155549058) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[3-(4-isoquinolin-1-ylpiperazin-1-yl)propylamino]-5,6,7,8-tetrahydrochromen-2-one.
| Compound Name | 4-[3-(4-isoquinolin-1-ylpiperazin-1-yl)propylamino]-5,6,7,8-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 155549058 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-[3-(4-isoquinolin-1-ylpiperazin-1-yl)propylamino]-5,6,7,8-tetrahydrochromen-2-one |
| SMILES | O=c1cc(NCCCN2CCN(c3nccc4ccccc34)CC2)c2c(o1)CCCC2 |
| InChI | InChI=1S/C25H30N4O2/c30-24-18-22(21-8-3-4-9-23(21)31-24)26-11-5-13-28-14-16-29(17-15-28)25-20-7-2-1-6-19(20)10-12-27-25/h1-2,6-7,10,12,18,26H,3-5,8-9,11,13-17H2 |
| InChIKey | BCFWSQVNSHUZSU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|