C28H26N2O7 — CID 140829695
methyl 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(4-methoxyphenyl)-3-oxopropanoate (PubChem CID 140829695) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is methyl 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(4-methoxyphenyl)-3-oxopropanoate.
| Compound Name | methyl 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(4-methoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 140829695 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | methyl 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(4-methoxyphenyl)-3-oxopropanoate |
| SMILES | COC(=O)C(NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H26N2O7/c1-35-18-13-11-17(12-14-18)26(32)25(27(33)36-2)30-24(31)15-29-28(34)37-16-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-14,23,25H,15-16H2,1-2H3,(H,29,34)(H,30,31) |
| InChIKey | ZQDHNGLVHFUSAP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|