C64H62IrN3- — CID 140838643
4,6-bis(1-adamantyl)-2-[6-[3-(9,9-dimethylfluoren-2-yl)-4-[2-(3,5-dimethylphenyl)phenyl]benzene-6-id-1-yl]-3-pyridinyl]pyrimidine;iridium (PubChem CID 140838643) has the molecular formula C64H62IrN3- and a molecular weight of 1065.44 g/mol. Its IUPAC name is 4,6-bis(1-adamantyl)-2-[6-[3-(9,9-dimethylfluoren-2-yl)-4-[2-(3,5-dimethylphenyl)phenyl]benzene-6-id-1-yl]-3-pyridinyl]pyrimidine;iridium.
| Compound Name | 4,6-bis(1-adamantyl)-2-[6-[3-(9,9-dimethylfluoren-2-yl)-4-[2-(3,5-dimethylphenyl)phenyl]benzene-6-id-1-yl]-3-pyridinyl]pyrimidine;iridium |
|---|---|
| PubChem CID | 140838643 |
| Molecular Formula | C64H62IrN3- |
| Molecular Weight | 1065.44 g/mol |
| Exact Mass | 1065.46 |
| IUPAC Name | 4,6-bis(1-adamantyl)-2-[6-[3-(9,9-dimethylfluoren-2-yl)-4-[2-(3,5-dimethylphenyl)phenyl]benzene-6-id-1-yl]-3-pyridinyl]pyrimidine;iridium |
| SMILES | Cc1cc(C)cc(-c2ccccc2-c2c[c-]c(-c3ccc(-c4nc(C56CC7CC(CC(C7)C5)C6)cc(C56CC7CC(CC(C7)C5)C6)n4)cn3)cc2-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1.[Ir] |
| InChI | InChI=1S/C64H62N3.Ir/c1-38-19-39(2)21-49(20-38)50-9-5-6-10-51(50)52-16-14-47(28-55(52)46-13-17-54-53-11-7-8-12-56(53)62(3,4)57(54)29-46)58-18-15-48(37-65-58)61-66-59(63-31-40-22-41(32-63)24-42(23-40)33-63)30-60(67-61)64-34-43-25-44(35-64)27-45(26-43)36-64;/h5-13,15-21,28-30,37,40-45H,22-27,31-36H2,1-4H3;/q-1; |
| InChIKey | QKIOBPLONKACKJ-UHFFFAOYSA-N |
| XLogP | 15.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.44 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|