C11H18 — CID 140839402
6-ethenyl-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 140839402) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 6-ethenyl-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | 6-ethenyl-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 140839402 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6-ethenyl-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | C=CC1(C)CCC2CCCC21 |
| InChI | InChI=1S/C11H18/c1-3-11(2)8-7-9-5-4-6-10(9)11/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | RZXWRZOFZFDOHS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|