C27H20ClN3O2 — CID 140843185
6-chloro-3-[3-(1-ethylbenzimidazol-2-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 140843185) has the molecular formula C27H20ClN3O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 6-chloro-3-[3-(1-ethylbenzimidazol-2-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[3-(1-ethylbenzimidazol-2-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 140843185 |
| Molecular Formula | C27H20ClN3O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 6-chloro-3-[3-(1-ethylbenzimidazol-2-yl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | CCn1c(C=CC(=O)c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)nc2ccccc21 |
| InChI | InChI=1S/C27H20ClN3O2/c1-2-31-22-11-7-6-10-21(22)29-24(31)15-14-23(32)26-25(17-8-4-3-5-9-17)19-16-18(28)12-13-20(19)30-27(26)33/h3-16H,2H2,1H3,(H,30,33) |
| InChIKey | YKMOQHSJUQKLPC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|