C43H26N2 — CID 140843697
2-(4-isocyanophenyl)-5-spiro[benzo[b]fluorene-11,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-ylpyridine (PubChem CID 140843697) has the molecular formula C43H26N2 and a molecular weight of 570.70 g/mol. Its IUPAC name is 2-(4-isocyanophenyl)-5-spiro[benzo[b]fluorene-11,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-ylpyridine.
| Compound Name | 2-(4-isocyanophenyl)-5-spiro[benzo[b]fluorene-11,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-ylpyridine |
|---|---|
| PubChem CID | 140843697 |
| Molecular Formula | C43H26N2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 2-(4-isocyanophenyl)-5-spiro[benzo[b]fluorene-11,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-ylpyridine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccc4c(c3)C3(c5ccccc5C=C4)c4ccccc4-c4cc5ccccc5cc43)cn2)cc1 |
| InChI | InChI=1S/C43H26N2/c1-44-35-21-18-30(19-22-35)42-23-20-34(27-45-42)33-17-16-29-15-14-28-8-4-6-12-38(28)43(40(29)25-33)39-13-7-5-11-36(39)37-24-31-9-2-3-10-32(31)26-41(37)43/h2-27H |
| InChIKey | UNGKGAQMJVRSNT-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|