C39H46N4O3 — CID 140844129
2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-pyridin-2-ylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione (PubChem CID 140844129) has the molecular formula C39H46N4O3 and a molecular weight of 618.82 g/mol. Its IUPAC name is 2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-pyridin-2-ylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione.
| Compound Name | 2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-pyridin-2-ylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
|---|---|
| PubChem CID | 140844129 |
| Molecular Formula | C39H46N4O3 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-pyridin-2-ylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=CC2(C)C3=CC(=O)C4C5CC(C)(C)CCC5(C(=O)n5ccnc5-c5ccccn5)CCC4(C)C3(C)CCC2C(C)(C)C1=O |
| InChI | InChI=1S/C39H46N4O3/c1-34(2)14-16-39(33(46)43-20-19-42-32(43)25-11-9-10-18-41-25)17-15-38(7)30(24(39)22-34)27(44)21-29-36(5)23-26(40-8)31(45)35(3,4)28(36)12-13-37(29,38)6/h9-11,18-21,23-24,28,30H,12-17,22H2,1-7H3 |
| InChIKey | GLEDBYOPSCXGBS-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|