C17H31NO7S — CID 140846941
tert-butyl 3-(methylsulfonyloxymethyl)-4-(2-oxo-2-propan-2-yloxyethyl)piperidine-1-carboxylate (PubChem CID 140846941) has the molecular formula C17H31NO7S and a molecular weight of 393.50 g/mol. Its IUPAC name is tert-butyl 3-(methylsulfonyloxymethyl)-4-(2-oxo-2-propan-2-yloxyethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(methylsulfonyloxymethyl)-4-(2-oxo-2-propan-2-yloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140846941 |
| Molecular Formula | C17H31NO7S |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl 3-(methylsulfonyloxymethyl)-4-(2-oxo-2-propan-2-yloxyethyl)piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1COS(C)(=O)=O |
| InChI | InChI=1S/C17H31NO7S/c1-12(2)24-15(19)9-13-7-8-18(16(20)25-17(3,4)5)10-14(13)11-23-26(6,21)22/h12-14H,7-11H2,1-6H3 |
| InChIKey | GGVGKIMUKSKQCC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|