C28H76N4O12Si5+4 — CID 140847472
3-[dihydroxy-tris[[3-[ethyl(dimethyl)azaniumyl]propyl-dihydroxysilyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium (PubChem CID 140847472) has the molecular formula C28H76N4O12Si5+4 and a molecular weight of 801.36 g/mol. Its IUPAC name is 3-[dihydroxy-tris[[3-[ethyl(dimethyl)azaniumyl]propyl-dihydroxysilyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium.
| Compound Name | 3-[dihydroxy-tris[[3-[ethyl(dimethyl)azaniumyl]propyl-dihydroxysilyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 140847472 |
| Molecular Formula | C28H76N4O12Si5+4 |
| Molecular Weight | 801.36 g/mol |
| Exact Mass | 800.43 |
| IUPAC Name | 3-[dihydroxy-tris[[3-[ethyl(dimethyl)azaniumyl]propyl-dihydroxysilyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCC[Si](O)(O)O[Si](O[Si](O)(O)CCC[N+](C)(C)CC)(O[Si](O)(O)CCC[N+](C)(C)CC)O[Si](O)(O)CCC[N+](C)(C)CC |
| InChI | InChI=1S/C28H76N4O12Si5/c1-13-29(5,6)21-17-25-45(33,34)41-49(42-46(35,36)26-18-22-30(7,8)14-2,43-47(37,38)27-19-23-31(9,10)15-3)44-48(39,40)28-20-24-32(11,12)16-4/h33-40H,13-28H2,1-12H3/q+4 |
| InChIKey | UYXJDSKXOAJVCT-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|