C28H58NO18Si5+ — CID 169322511
3-[dihydroxy-tris[[dihydroxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium (PubChem CID 169322511) has the molecular formula C28H58NO18Si5+ and a molecular weight of 837.19 g/mol. Its IUPAC name is 3-[dihydroxy-tris[[dihydroxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium.
| Compound Name | 3-[dihydroxy-tris[[dihydroxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 169322511 |
| Molecular Formula | C28H58NO18Si5+ |
| Molecular Weight | 837.19 g/mol |
| Exact Mass | 836.25 |
| IUPAC Name | 3-[dihydroxy-tris[[dihydroxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy]silyloxysilyl]propyl-ethyl-dimethylazanium |
| SMILES | C=C(C)C(=O)OCCC[Si](O)(O)O[Si](O[Si](O)(O)CCCOC(=O)C(=C)C)(O[Si](O)(O)CCCOC(=O)C(=C)C)O[Si](O)(O)CCC[N+](C)(C)CC |
| InChI | InChI=1S/C28H58NO18Si5/c1-10-29(8,9)15-11-19-48(33,34)44-52(45-49(35,36)20-12-16-41-26(30)23(2)3,46-50(37,38)21-13-17-42-27(31)24(4)5)47-51(39,40)22-14-18-43-28(32)25(6)7/h33-40H,2,4,6,10-22H2,1,3,5,7-9H3/q+1 |
| InChIKey | ZCMVQGCRBXARPZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 277.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|