C24H68N4O12Si5+4 — CID 159273706
3-[dihydroxy-tris[[dihydroxy-[3-(trimethylazaniumyl)propyl]silyl]oxy]silyloxysilyl]propyl-trimethylazanium (PubChem CID 159273706) has the molecular formula C24H68N4O12Si5+4 and a molecular weight of 745.25 g/mol. Its IUPAC name is 3-[dihydroxy-tris[[dihydroxy-[3-(trimethylazaniumyl)propyl]silyl]oxy]silyloxysilyl]propyl-trimethylazanium.
| Compound Name | 3-[dihydroxy-tris[[dihydroxy-[3-(trimethylazaniumyl)propyl]silyl]oxy]silyloxysilyl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 159273706 |
| Molecular Formula | C24H68N4O12Si5+4 |
| Molecular Weight | 745.25 g/mol |
| Exact Mass | 744.37 |
| IUPAC Name | 3-[dihydroxy-tris[[dihydroxy-[3-(trimethylazaniumyl)propyl]silyl]oxy]silyloxysilyl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCC[Si](O)(O)O[Si](O[Si](O)(O)CCC[N+](C)(C)C)(O[Si](O)(O)CCC[N+](C)(C)C)O[Si](O)(O)CCC[N+](C)(C)C |
| InChI | InChI=1S/C24H68N4O12Si5/c1-25(2,3)17-13-21-41(29,30)37-45(38-42(31,32)22-14-18-26(4,5)6,39-43(33,34)23-15-19-27(7,8)9)40-44(35,36)24-16-20-28(10,11)12/h29-36H,13-24H2,1-12H3/q+4 |
| InChIKey | ZZZPEOOJTIJUSG-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.25 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|