About 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine
4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine (PubChem CID 140851998) has the molecular formula C18H17Cl2N3O
and a molecular weight of 362.26 g/mol. Its IUPAC name is 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine |
| PubChem CID | 140851998 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine |
| SMILES | COCc1nc2c(C3CC3)nccc2n1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O/c1-24-10-16-22-18-15(6-7-21-17(18)11-2-3-11)23(16)9-12-8-13(19)4-5-14(12)20/h4-8,11H,2-3,9-10H2,1H3 |
| InChIKey | MNSUWLQDZSHKTB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine?
The IUPAC name of 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine (CID 140851998) is 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine.
What is the SMILES notation for 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine?
The canonical SMILES for 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine is COCc1nc2c(C3CC3)nccc2n1Cc1cc(Cl)ccc1Cl.
What is the InChIKey of 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine?
The InChIKey is MNSUWLQDZSHKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3O/c1-24-10-16-22-18-15(6-7-21-17(18)11-2-3-11)23(16)9-12-8-13(19)4-5-14(12)20/h4-8,11H,2-3,9-10H2,1H3.
What are the key properties of 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine?
4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine has a molecular weight of 362.26 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-2-(methoxymethyl)imidazo[4,5-c]pyridine is sourced from PubChem (CID 140851998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).