C21H19Cl2N — CID 129251723
5-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-4-phenyl-2H-pyridine (PubChem CID 129251723) has the molecular formula C21H19Cl2N and a molecular weight of 356.30 g/mol. Its IUPAC name is 5-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-4-phenyl-2H-pyridine.
| Compound Name | 5-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-4-phenyl-2H-pyridine |
|---|---|
| PubChem CID | 129251723 |
| Molecular Formula | C21H19Cl2N |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-4-phenyl-2H-pyridine |
| SMILES | Clc1ccc(Cl)c(CN2C=C(C3CC3)C(c3ccccc3)=CC2)c1 |
| InChI | InChI=1S/C21H19Cl2N/c22-18-8-9-21(23)17(12-18)13-24-11-10-19(15-4-2-1-3-5-15)20(14-24)16-6-7-16/h1-5,8-10,12,14,16H,6-7,11,13H2 |
| InChIKey | JZDGKEHOBPFSHK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |