C38H67NO7P- — CID 140855738
2-[2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propoxy]ethoxy]ethoxy-propan-2-ylphosphinate (PubChem CID 140855738) has the molecular formula C38H67NO7P- and a molecular weight of 680.93 g/mol. Its IUPAC name is 2-[2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propoxy]ethoxy]ethoxy-propan-2-ylphosphinate.
| Compound Name | 2-[2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propoxy]ethoxy]ethoxy-propan-2-ylphosphinate |
|---|---|
| PubChem CID | 140855738 |
| Molecular Formula | C38H67NO7P- |
| Molecular Weight | 680.93 g/mol |
| Exact Mass | 680.47 |
| IUPAC Name | 2-[2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propoxy]ethoxy]ethoxy-propan-2-ylphosphinate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCOCCOCCOP(=O)([O-])C(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H68NO7P/c1-27(2)10-8-11-29(5)33-14-15-34-32-13-12-30-26-31(16-18-37(30,6)35(32)17-19-38(33,34)7)46-36(40)39-20-9-21-43-22-23-44-24-25-45-47(41,42)28(3)4/h12,27-29,31-35H,8-11,13-26H2,1-7H3,(H,39,40)(H,41,42)/p-1 |
| InChIKey | WFRLZQBFAKBTTG-UHFFFAOYSA-M |
| XLogP | 8.52 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.93 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|