C38H68NO9P — CID 69479092
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[2-[2-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]propyl]carbamate (PubChem CID 69479092) has the molecular formula C38H68NO9P and a molecular weight of 713.93 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[2-[2-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]propyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[2-[2-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]propyl]carbamate |
|---|---|
| PubChem CID | 69479092 |
| Molecular Formula | C38H68NO9P |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.46 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[2-[2-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]propyl]carbamate |
| SMILES | COP(=O)(O)OCCOCCOCCOCCCNC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C38H68NO9P/c1-28(2)9-7-10-29(3)33-13-14-34-32-12-11-30-27-31(15-17-37(30,4)35(32)16-18-38(33,34)5)48-36(40)39-19-8-20-44-21-22-45-23-24-46-25-26-47-49(41,42)43-6/h11,28-29,31-35H,7-10,12-27H2,1-6H3,(H,39,40)(H,41,42) |
| InChIKey | GORLSWVLQSURMJ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|