C12H14BrF2N5 — CID 140856302
2-N'-(2-bromophenyl)-3,3-difluoropyrrolidine-1,2-dicarboximidamide (PubChem CID 140856302) has the molecular formula C12H14BrF2N5 and a molecular weight of 346.18 g/mol. Its IUPAC name is 2-N'-(2-bromophenyl)-3,3-difluoropyrrolidine-1,2-dicarboximidamide.
| Compound Name | 2-N'-(2-bromophenyl)-3,3-difluoropyrrolidine-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 140856302 |
| Molecular Formula | C12H14BrF2N5 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-N'-(2-bromophenyl)-3,3-difluoropyrrolidine-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(F)(F)C1/C(N)=N/c1ccccc1Br |
| InChI | InChI=1S/C12H14BrF2N5/c13-7-3-1-2-4-8(7)19-10(16)9-12(14,15)5-6-20(9)11(17)18/h1-4,9H,5-6H2,(H2,16,19)(H3,17,18) |
| InChIKey | MFUVVKPOKBMMJU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|