C13H14F5N5O — CID 140856287
3,3-difluoro-2-N'-[4-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboximidamide (PubChem CID 140856287) has the molecular formula C13H14F5N5O and a molecular weight of 351.28 g/mol. Its IUPAC name is 3,3-difluoro-2-N'-[4-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboximidamide.
| Compound Name | 3,3-difluoro-2-N'-[4-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 140856287 |
| Molecular Formula | C13H14F5N5O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3,3-difluoro-2-N'-[4-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(F)(F)C1/C(N)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F5N5O/c14-12(15)5-6-23(11(20)21)9(12)10(19)22-7-1-3-8(4-2-7)24-13(16,17)18/h1-4,9H,5-6H2,(H2,19,22)(H3,20,21) |
| InChIKey | FWFXKBLXEFLKAN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|