C14H19F2N5O — CID 140856327
4,4-difluoro-2-N'-(4-methoxyphenyl)piperidine-1,2-dicarboximidamide (PubChem CID 140856327) has the molecular formula C14H19F2N5O and a molecular weight of 311.34 g/mol. Its IUPAC name is 4,4-difluoro-2-N'-(4-methoxyphenyl)piperidine-1,2-dicarboximidamide.
| Compound Name | 4,4-difluoro-2-N'-(4-methoxyphenyl)piperidine-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 140856327 |
| Molecular Formula | C14H19F2N5O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4,4-difluoro-2-N'-(4-methoxyphenyl)piperidine-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(F)(F)CC1/C(N)=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19F2N5O/c1-22-10-4-2-9(3-5-10)20-12(17)11-8-14(15,16)6-7-21(11)13(18)19/h2-5,11H,6-8H2,1H3,(H2,17,20)(H3,18,19) |
| InChIKey | NVNSUZNXXYPMAW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|