C14H18ClF4N5O — CID 140856312
4-fluoro-2-N'-[4-(trifluoromethoxy)phenyl]piperidine-1,2-dicarboximidamide;hydrochloride (PubChem CID 140856312) has the molecular formula C14H18ClF4N5O and a molecular weight of 383.78 g/mol. Its IUPAC name is 4-fluoro-2-N'-[4-(trifluoromethoxy)phenyl]piperidine-1,2-dicarboximidamide;hydrochloride.
| Compound Name | 4-fluoro-2-N'-[4-(trifluoromethoxy)phenyl]piperidine-1,2-dicarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 140856312 |
| Molecular Formula | C14H18ClF4N5O |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-fluoro-2-N'-[4-(trifluoromethoxy)phenyl]piperidine-1,2-dicarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCC(F)CC1/C(N)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F4N5O.ClH/c15-8-5-6-23(13(20)21)11(7-8)12(19)22-9-1-3-10(4-2-9)24-14(16,17)18;/h1-4,8,11H,5-7H2,(H2,19,22)(H3,20,21);1H |
| InChIKey | DFHGGBRFYVFFLA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|