C20H30N6O — CID 140673420
2-N'-[4-(3-oxo-3-piperidin-1-ylpropyl)phenyl]pyrrolidine-1,2-dicarboximidamide (PubChem CID 140673420) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-N'-[4-(3-oxo-3-piperidin-1-ylpropyl)phenyl]pyrrolidine-1,2-dicarboximidamide.
| Compound Name | 2-N'-[4-(3-oxo-3-piperidin-1-ylpropyl)phenyl]pyrrolidine-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 140673420 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-N'-[4-(3-oxo-3-piperidin-1-ylpropyl)phenyl]pyrrolidine-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1/C(N)=N/c1ccc(CCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N6O/c21-19(17-5-4-14-26(17)20(22)23)24-16-9-6-15(7-10-16)8-11-18(27)25-12-2-1-3-13-25/h6-7,9-10,17H,1-5,8,11-14H2,(H2,21,24)(H3,22,23) |
| InChIKey | AHJAYVCIESEYHU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|