C36H42F2N2O4 — CID 140857971
(2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,3-difluorophenyl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857971) has the molecular formula C36H42F2N2O4 and a molecular weight of 604.74 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,3-difluorophenyl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,3-difluorophenyl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857971 |
| Molecular Formula | C36H42F2N2O4 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,3-difluorophenyl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(-c2cccc(F)c2F)cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C2CCCCC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C36H42F2N2O4/c1-36(2,3)29-31(39-21-25-20-24(18-19-28(25)44-4)26-16-11-17-27(37)30(26)38)32(22-12-7-5-8-13-22)40(33(29)35(42)43)34(41)23-14-9-6-10-15-23/h5,7-8,11-13,16-20,23,29,31-33,39H,6,9-10,14-15,21H2,1-4H3,(H,42,43)/t29-,31-,32-,33-/m0/s1 |
| InChIKey | JINLLZZVHTUXJX-BBXFGWPUSA-N |
| XLogP | 7.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |