C27H15Cl3F9N3O3 — CID 140859678
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-methylbenzamide (PubChem CID 140859678) has the molecular formula C27H15Cl3F9N3O3 and a molecular weight of 706.78 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-methylbenzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 140859678 |
| Molecular Formula | C27H15Cl3F9N3O3 |
| Molecular Weight | 706.78 g/mol |
| Exact Mass | 705.00 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(NC(=O)[C@H]2[C@H](c3ccc(F)c(C(F)(F)F)c3)C2(Cl)Cl)ccc1Cl)c1ccc(F)c(NC(=O)C(F)(F)F)c1F |
| InChI | InChI=1S/C27H15Cl3F9N3O3/c1-42(17-7-6-16(32)21(20(17)33)41-24(45)27(37,38)39)23(44)12-9-11(3-4-14(12)28)40-22(43)19-18(25(19,29)30)10-2-5-15(31)13(8-10)26(34,35)36/h2-9,18-19H,1H3,(H,40,43)(H,41,45)/t18-,19+/m0/s1 |
| InChIKey | CFNOGASXIJIAHW-RBUKOAKNSA-N |
| XLogP | 8.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.78 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|