C24H16Cl5F2N3O2 — CID 134413150
N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methylbenzamide (PubChem CID 134413150) has the molecular formula C24H16Cl5F2N3O2 and a molecular weight of 593.67 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methylbenzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 134413150 |
| Molecular Formula | C24H16Cl5F2N3O2 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 590.97 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(NC(=O)C2[C@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C24H16Cl5F2N3O2/c1-34(17-7-6-16(30)21(32)20(17)31)23(36)12-9-11(3-5-13(12)25)33-22(35)19-18(24(19,28)29)10-2-4-14(26)15(27)8-10/h2-9,18-19H,32H2,1H3,(H,33,35)/t18-,19?/m0/s1 |
| InChIKey | NXTPJIHPFLXGJS-OYKVQYDMSA-N |
| XLogP | 7.31 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|