C13H15BrO3 — CID 140860812
ethyl 3-(4-bromophenyl)-3-hydroxycyclobutane-1-carboxylate (PubChem CID 140860812) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-3-hydroxycyclobutane-1-carboxylate.
| Compound Name | ethyl 3-(4-bromophenyl)-3-hydroxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 140860812 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-3-hydroxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(O)(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C13H15BrO3/c1-2-17-12(15)9-7-13(16,8-9)10-3-5-11(14)6-4-10/h3-6,9,16H,2,7-8H2,1H3 |
| InChIKey | LUOBXGWFBWOPKM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |