C14H17NO4 — CID 140629827
ethyl 3-hydroxy-3-[4-[(E)-hydroxyiminomethyl]phenyl]cyclobutane-1-carboxylate (PubChem CID 140629827) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-[4-[(E)-hydroxyiminomethyl]phenyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 3-hydroxy-3-[4-[(E)-hydroxyiminomethyl]phenyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 140629827 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 3-hydroxy-3-[4-[(E)-hydroxyiminomethyl]phenyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(O)(c2ccc(/C=N/O)cc2)C1 |
| InChI | InChI=1S/C14H17NO4/c1-2-19-13(16)11-7-14(17,8-11)12-5-3-10(4-6-12)9-15-18/h3-6,9,11,17-18H,2,7-8H2,1H3/b15-9+ |
| InChIKey | JWXNXSMJITYOHT-OQLLNIDSSA-N |
| XLogP | 1.66 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|