C17H22O5 — CID 156762729
ethyl 4-(3-formyl-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 156762729) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 4-(3-formyl-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(3-formyl-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 156762729 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethyl 4-(3-formyl-4-methoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(c2ccc(OC)c(C=O)c2)CC1 |
| InChI | InChI=1S/C17H22O5/c1-3-22-16(19)12-6-8-17(20,9-7-12)14-4-5-15(21-2)13(10-14)11-18/h4-5,10-12,20H,3,6-9H2,1-2H3 |
| InChIKey | XMDPOSHGWQBHLW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|