C24H27N3O5 — CID 140863161
butyl N-[N'-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)carbamimidoyl]carbamate (PubChem CID 140863161) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is butyl N-[N'-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)carbamimidoyl]carbamate.
| Compound Name | butyl N-[N'-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 140863161 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | butyl N-[N'-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)carbamimidoyl]carbamate |
| SMILES | CCCCOC(=O)N/C(N)=N/C12C(=O)c3ccccc3C1(O)Oc1cc(C(C)C)ccc12 |
| InChI | InChI=1S/C24H27N3O5/c1-4-5-12-31-22(29)26-21(25)27-23-18-11-10-15(14(2)3)13-19(18)32-24(23,30)17-9-7-6-8-16(17)20(23)28/h6-11,13-14,30H,4-5,12H2,1-3H3,(H3,25,26,27,29) |
| InChIKey | LAVCGTYAAYMPRL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|