C23H19NO3S2 — CID 71488468
N-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)thiophene-2-carbothioamide (PubChem CID 71488468) has the molecular formula C23H19NO3S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)thiophene-2-carbothioamide.
| Compound Name | N-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 71488468 |
| Molecular Formula | C23H19NO3S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-(4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)thiophene-2-carbothioamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3ccccc3C(=O)C21NC(=S)c1cccs1 |
| InChI | InChI=1S/C23H19NO3S2/c1-13(2)14-9-10-17-18(12-14)27-23(26)16-7-4-3-6-15(16)20(25)22(17,23)24-21(28)19-8-5-11-29-19/h3-13,26H,1-2H3,(H,24,28) |
| InChIKey | ZGRKYVMXDIBWQH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|